C16H11ClF3N3O4 — CID 7291568
2-chloro-N-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 7291568) has the molecular formula C16H11ClF3N3O4 and a molecular weight of 401.73 g/mol. Its IUPAC name is 2-chloro-N-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | 2-chloro-N-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 7291568 |
| Molecular Formula | C16H11ClF3N3O4 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-chloro-N-[(4S)-1-(furan-2-ylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | O=C(N[C@]1(C(F)(F)F)NC(=O)N(Cc2ccco2)C1=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H11ClF3N3O4/c17-11-6-2-1-5-10(11)12(24)21-15(16(18,19)20)13(25)23(14(26)22-15)8-9-4-3-7-27-9/h1-7H,8H2,(H,21,24)(H,22,26)/t15-/m0/s1 |
| InChIKey | OBXOORBZEYLYSC-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|