C12H8Cl2F3N3O3 — CID 3934217
2,4-dichloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 3934217) has the molecular formula C12H8Cl2F3N3O3 and a molecular weight of 370.11 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 3934217 |
| Molecular Formula | C12H8Cl2F3N3O3 |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2,4-dichloro-N-[1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | CN1C(=O)NC(NC(=O)c2ccc(Cl)cc2Cl)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C12H8Cl2F3N3O3/c1-20-9(22)11(12(15,16)17,19-10(20)23)18-8(21)6-3-2-5(13)4-7(6)14/h2-4H,1H3,(H,18,21)(H,19,23) |
| InChIKey | FEOYCFKIGVXVIR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|