C21H16ClF3N4O3 — CID 41091994
N-[(4S)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 41091994) has the molecular formula C21H16ClF3N4O3 and a molecular weight of 464.83 g/mol. Its IUPAC name is N-[(4S)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | N-[(4S)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 41091994 |
| Molecular Formula | C21H16ClF3N4O3 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[(4S)-1-[2-(5-chloro-1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | O=C(N[C@]1(C(F)(F)F)NC(=O)N(CCc2c[nH]c3ccc(Cl)cc23)C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H16ClF3N4O3/c22-14-6-7-16-15(10-14)13(11-26-16)8-9-29-18(31)20(21(23,24)25,28-19(29)32)27-17(30)12-4-2-1-3-5-12/h1-7,10-11,26H,8-9H2,(H,27,30)(H,28,32)/t20-/m0/s1 |
| InChIKey | YVVMHRZHIILQMA-FQEVSTJZSA-N |
| XLogP | 3.60 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|