C21H17F3N4O3 — CID 4908776
N-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 4908776) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is N-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | N-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 4908776 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[1-[2-(1H-indol-3-yl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | O=C(NC1(C(F)(F)F)NC(=O)N(CCc2c[nH]c3ccccc23)C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H17F3N4O3/c22-21(23,24)20(26-17(29)13-6-2-1-3-7-13)18(30)28(19(31)27-20)11-10-14-12-25-16-9-5-4-8-15(14)16/h1-9,12,25H,10-11H2,(H,26,29)(H,27,31) |
| InChIKey | PAAMENHQRHRYJB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|