C15H15ClF3N3O3 — CID 7236136
N-[(4S)-1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-chlorobenzamide (PubChem CID 7236136) has the molecular formula C15H15ClF3N3O3 and a molecular weight of 377.75 g/mol. Its IUPAC name is N-[(4S)-1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-chlorobenzamide.
| Compound Name | N-[(4S)-1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 7236136 |
| Molecular Formula | C15H15ClF3N3O3 |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[(4S)-1-butyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-chlorobenzamide |
| SMILES | CCCCN1C(=O)N[C@](NC(=O)c2cccc(Cl)c2)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C15H15ClF3N3O3/c1-2-3-7-22-12(24)14(15(17,18)19,21-13(22)25)20-11(23)9-5-4-6-10(16)8-9/h4-6,8H,2-3,7H2,1H3,(H,20,23)(H,21,25)/t14-/m0/s1 |
| InChIKey | UJPWPDPUXLNLSY-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|