C13H13ClN2O2S — CID 30479318
(5S)-3-[(2-chlorophenyl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 30479318) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is (5S)-3-[(2-chlorophenyl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-3-[(2-chlorophenyl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 30479318 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (5S)-3-[(2-chlorophenyl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1N[C@@]2(CCSC2)C(=O)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C13H13ClN2O2S/c14-10-4-2-1-3-9(10)7-16-11(17)13(15-12(16)18)5-6-19-8-13/h1-4H,5-8H2,(H,15,18)/t13-/m1/s1 |
| InChIKey | QQMDNDBIPMNNJD-CYBMUJFWSA-N |
| XLogP | 2.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|