C14H14F2N2O3S — CID 60558782
3-[[4-(difluoromethoxy)phenyl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 60558782) has the molecular formula C14H14F2N2O3S and a molecular weight of 328.34 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)phenyl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[[4-(difluoromethoxy)phenyl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 60558782 |
| Molecular Formula | C14H14F2N2O3S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 3-[[4-(difluoromethoxy)phenyl]methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCSC2)C(=O)N1Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H14F2N2O3S/c15-12(16)21-10-3-1-9(2-4-10)7-18-11(19)14(17-13(18)20)5-6-22-8-14/h1-4,12H,5-8H2,(H,17,20) |
| InChIKey | TXECEZOUMKCGAG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|