C21H27F2N3O4 — CID 47093751
N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-methylacetamide (PubChem CID 47093751) has the molecular formula C21H27F2N3O4 and a molecular weight of 423.46 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-methylacetamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 47093751 |
| Molecular Formula | C21H27F2N3O4 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-N-methylacetamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)CN1C(=O)NC2(CCCCCCC2)C1=O |
| InChI | InChI=1S/C21H27F2N3O4/c1-25(13-15-7-9-16(10-8-15)30-19(22)23)17(27)14-26-18(28)21(24-20(26)29)11-5-3-2-4-6-12-21/h7-10,19H,2-6,11-14H2,1H3,(H,24,29) |
| InChIKey | BOWONGWULFUORW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|