C19H24F2N4O4 — CID 55393685
2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55393685) has the molecular formula C19H24F2N4O4 and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55393685 |
| Molecular Formula | C19H24F2N4O4 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CN(CC(=O)NN1C(=O)NC2(CCCCC2)C1=O)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H24F2N4O4/c1-24(11-13-5-7-14(8-6-13)29-17(20)21)12-15(26)23-25-16(27)19(22-18(25)28)9-3-2-4-10-19/h5-8,17H,2-4,9-12H2,1H3,(H,22,28)(H,23,26) |
| InChIKey | YKFIZZOWNRRIFD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|