C14H19F2N3O3 — CID 9023545
2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(ethylcarbamoyl)acetamide (PubChem CID 9023545) has the molecular formula C14H19F2N3O3 and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9023545 |
| Molecular Formula | C14H19F2N3O3 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCNC(=O)NC(=O)CN(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H19F2N3O3/c1-3-17-14(21)18-12(20)9-19(2)8-10-4-6-11(7-5-10)22-13(15)16/h4-7,13H,3,8-9H2,1-2H3,(H2,17,18,20,21) |
| InChIKey | GIPVLNFCJBWZMT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |