C17H17F2IN2O2 — CID 27218169
2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(4-iodophenyl)acetamide (PubChem CID 27218169) has the molecular formula C17H17F2IN2O2 and a molecular weight of 446.24 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 27218169 |
| Molecular Formula | C17H17F2IN2O2 |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(4-iodophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(I)cc1)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H17F2IN2O2/c1-22(10-12-2-8-15(9-3-12)24-17(18)19)11-16(23)21-14-6-4-13(20)5-7-14/h2-9,17H,10-11H2,1H3,(H,21,23) |
| InChIKey | VEAMDHQJCPIKEU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|