C22H26N4O4 — CID 43013055
N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide (PubChem CID 43013055) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide.
| Compound Name | N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 43013055 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-[(4-methoxyphenyl)methyl-methylamino]acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(NC(=O)CN(C)Cc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C22H26N4O4/c1-4-22(17-8-6-5-7-9-17)20(28)26(21(29)23-22)24-19(27)15-25(2)14-16-10-12-18(30-3)13-11-16/h5-13H,4,14-15H2,1-3H3,(H,23,29)(H,24,27) |
| InChIKey | AQCYDKJGHNUMOT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|