C24H24N4O3 — CID 8599891
N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide (PubChem CID 8599891) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide.
| Compound Name | N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 8599891 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide |
| SMILES | CN(CC(=O)NN1C(=O)N[C@@](C)(c2ccccc2)C1=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H24N4O3/c1-24(20-10-4-3-5-11-20)22(30)28(23(31)25-24)26-21(29)16-27(2)15-17-12-13-18-8-6-7-9-19(18)14-17/h3-14H,15-16H2,1-2H3,(H,25,31)(H,26,29)/t24-/m0/s1 |
| InChIKey | ZHFVWGKOXXNNHQ-DEOSSOPVSA-N |
| XLogP | 2.77 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|