C22H25FN4O3 — CID 18088033
2-[(3-fluorophenyl)methyl-methylamino]-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide (PubChem CID 18088033) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl-methylamino]-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide.
| Compound Name | 2-[(3-fluorophenyl)methyl-methylamino]-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 18088033 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl-methylamino]-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
| SMILES | CN(CC(=O)NN1C(=O)NC(C)(CCc2ccccc2)C1=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C22H25FN4O3/c1-22(12-11-16-7-4-3-5-8-16)20(29)27(21(30)24-22)25-19(28)15-26(2)14-17-9-6-10-18(23)13-17/h3-10,13H,11-12,14-15H2,1-2H3,(H,24,30)(H,25,28) |
| InChIKey | HAVYSZQCIRWILZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|