C21H22N4O5 — CID 8924194
2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 8924194) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8924194 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl(methyl)amino]-N-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | CN(CC(=O)NN1C(=O)N[C@@](C)(c2ccccc2)C1=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H22N4O5/c1-21(15-6-4-3-5-7-15)19(27)25(20(28)22-21)23-18(26)12-24(2)11-14-8-9-16-17(10-14)30-13-29-16/h3-10H,11-13H2,1-2H3,(H,22,28)(H,23,26)/t21-/m0/s1 |
| InChIKey | VYMMVCNIGLYVBZ-NRFANRHFSA-N |
| XLogP | 1.35 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|