C20H20N4O5S — CID 41013708
1-(1,3-benzodioxol-5-ylmethyl)-3-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea (PubChem CID 41013708) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea |
|---|---|
| PubChem CID | 41013708 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea |
| SMILES | COc1cccc([C@@]2(C)NC(=O)N(NC(=S)NCc3ccc4c(c3)OCO4)C2=O)c1 |
| InChI | InChI=1S/C20H20N4O5S/c1-20(13-4-3-5-14(9-13)27-2)17(25)24(19(26)22-20)23-18(30)21-10-12-6-7-15-16(8-12)29-11-28-15/h3-9H,10-11H2,1-2H3,(H,22,26)(H2,21,23,30)/t20-/m1/s1 |
| InChIKey | IGSOOKSNIGYOBX-HXUWFJFHSA-N |
| XLogP | 1.77 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|