C20H22N4O3S — CID 8683821
1-(3,4-dimethylphenyl)-3-[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea (PubChem CID 8683821) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea |
|---|---|
| PubChem CID | 8683821 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[(4S)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea |
| SMILES | COc1cccc([C@]2(C)NC(=O)N(NC(=S)Nc3ccc(C)c(C)c3)C2=O)c1 |
| InChI | InChI=1S/C20H22N4O3S/c1-12-8-9-15(10-13(12)2)21-18(28)23-24-17(25)20(3,22-19(24)26)14-6-5-7-16(11-14)27-4/h5-11H,1-4H3,(H,22,26)(H2,21,23,28)/t20-/m0/s1 |
| InChIKey | LDCDYMRPKVWGRT-FQEVSTJZSA-N |
| XLogP | 2.98 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|