C19H20N4O2S — CID 8679353
1-(4-ethylphenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea (PubChem CID 8679353) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea |
|---|---|
| PubChem CID | 8679353 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea |
| SMILES | CCc1ccc(NC(=S)NN2C(=O)N[C@@](C)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-3-13-9-11-15(12-10-13)20-17(26)22-23-16(24)19(2,21-18(23)25)14-7-5-4-6-8-14/h4-12H,3H2,1-2H3,(H,21,25)(H2,20,22,26)/t19-/m0/s1 |
| InChIKey | SAYFXNUCMIHENJ-IBGZPJMESA-N |
| XLogP | 2.92 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|