C16H24N5O2S+ — CID 2621344
dimethyl-[3-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]carbamothioylamino]propyl]azanium (PubChem CID 2621344) has the molecular formula C16H24N5O2S+ and a molecular weight of 350.47 g/mol. Its IUPAC name is dimethyl-[3-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]carbamothioylamino]propyl]azanium.
| Compound Name | dimethyl-[3-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]carbamothioylamino]propyl]azanium |
|---|---|
| PubChem CID | 2621344 |
| Molecular Formula | C16H24N5O2S+ |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | dimethyl-[3-[[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]carbamothioylamino]propyl]azanium |
| SMILES | C[NH+](C)CCCNC(=S)NN1C(=O)N[C@@](C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H23N5O2S/c1-16(12-8-5-4-6-9-12)13(22)21(15(23)18-16)19-14(24)17-10-7-11-20(2)3/h4-6,8-9H,7,10-11H2,1-3H3,(H,18,23)(H2,17,19,24)/p+1/t16-/m0/s1 |
| InChIKey | NDKMEOOVVDJISS-INIZCTEOSA-O |
| XLogP | -0.63 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|