C18H26N5O3S+ — CID 8766612
1-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 8766612) has the molecular formula C18H26N5O3S+ and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8766612 |
| Molecular Formula | C18H26N5O3S+ |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(NC(=S)NCCC[NH+]2CCOCC2)C1=O |
| InChI | InChI=1S/C18H25N5O3S/c1-18(14-6-3-2-4-7-14)15(24)23(17(25)20-18)21-16(27)19-8-5-9-22-10-12-26-13-11-22/h2-4,6-7H,5,8-13H2,1H3,(H,20,25)(H2,19,21,27)/p+1/t18-/m0/s1 |
| InChIKey | RBAZBSLGFHOJIU-SFHVURJKSA-O |
| XLogP | -0.86 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|