C14H17N5O4S — CID 8789062
1-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-3-propylthiourea (PubChem CID 8789062) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is 1-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-3-propylthiourea.
| Compound Name | 1-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-3-propylthiourea |
|---|---|
| PubChem CID | 8789062 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 1-[(4S)-4-methyl-4-(4-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]-3-propylthiourea |
| SMILES | CCCNC(=S)NN1C(=O)N[C@@](C)(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C14H17N5O4S/c1-3-8-15-12(24)17-18-11(20)14(2,16-13(18)21)9-4-6-10(7-5-9)19(22)23/h4-7H,3,8H2,1-2H3,(H,16,21)(H2,15,17,24)/t14-/m0/s1 |
| InChIKey | TWUBJSMRYVKENN-AWEZNQCLSA-N |
| XLogP | 1.15 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|