C19H20N4O2S — CID 9283101
1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-3-propylthiourea (PubChem CID 9283101) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-3-propylthiourea.
| Compound Name | 1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-3-propylthiourea |
|---|---|
| PubChem CID | 9283101 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-3-propylthiourea |
| SMILES | CCCNC(=S)NN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N4O2S/c1-2-13-20-17(26)22-23-16(24)19(21-18(23)25,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3,(H,21,25)(H2,20,22,26) |
| InChIKey | CLVFWELKPGHMKK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|