C20H22N4O2S — CID 9283078
1-butyl-3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)thiourea (PubChem CID 9283078) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-butyl-3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)thiourea.
| Compound Name | 1-butyl-3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)thiourea |
|---|---|
| PubChem CID | 9283078 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-butyl-3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)thiourea |
| SMILES | CCCCNC(=S)NN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H22N4O2S/c1-2-3-14-21-18(27)23-24-17(25)20(22-19(24)26,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3,(H,22,26)(H2,21,23,27) |
| InChIKey | GEECERWPOUYPTK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|