C15H24N3OS2+ — CID 8628012
1-(2-methylsulfanylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 8628012) has the molecular formula C15H24N3OS2+ and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-(2-methylsulfanylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-(2-methylsulfanylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8628012 |
| Molecular Formula | C15H24N3OS2+ |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-(2-methylsulfanylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | CSc1ccccc1NC(=S)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H23N3OS2/c1-21-14-6-3-2-5-13(14)17-15(20)16-7-4-8-18-9-11-19-12-10-18/h2-3,5-6H,4,7-12H2,1H3,(H2,16,17,20)/p+1 |
| InChIKey | QAQGDTJPHCEPFF-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|