C14H20FN4O3S+ — CID 2108551
1-(2-fluoro-5-nitrophenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 2108551) has the molecular formula C14H20FN4O3S+ and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-(2-fluoro-5-nitrophenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-(2-fluoro-5-nitrophenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 2108551 |
| Molecular Formula | C14H20FN4O3S+ |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-(2-fluoro-5-nitrophenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(F)c(NC(=S)NCCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C14H19FN4O3S/c15-12-3-2-11(19(20)21)10-13(12)17-14(23)16-4-1-5-18-6-8-22-9-7-18/h2-3,10H,1,4-9H2,(H2,16,17,23)/p+1 |
| InChIKey | NXOJYFSAZPZNQP-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|