C15H23BrN3OS+ — CID 7210075
1-(4-bromo-2-methylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 7210075) has the molecular formula C15H23BrN3OS+ and a molecular weight of 373.34 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-(4-bromo-2-methylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 7210075 |
| Molecular Formula | C15H23BrN3OS+ |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | Cc1cc(Br)ccc1NC(=S)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H22BrN3OS/c1-12-11-13(16)3-4-14(12)18-15(21)17-5-2-6-19-7-9-20-10-8-19/h3-4,11H,2,5-10H2,1H3,(H2,17,18,21)/p+1 |
| InChIKey | XCSZRMXKRFYHDB-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|