C18H28N3O3+ — CID 7034625
N-(3-morpholin-4-ium-4-ylpropyl)-N'-(2,4,6-trimethylphenyl)oxamide (PubChem CID 7034625) has the molecular formula C18H28N3O3+ and a molecular weight of 334.44 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropyl)-N'-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropyl)-N'-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 7034625 |
| Molecular Formula | C18H28N3O3+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropyl)-N'-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)NCCC[NH+]2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-13-11-14(2)16(15(3)12-13)20-18(23)17(22)19-5-4-6-21-7-9-24-10-8-21/h11-12H,4-10H2,1-3H3,(H,19,22)(H,20,23)/p+1 |
| InChIKey | USWSAXZSZABANQ-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|