C11H18N5O3S+ — CID 9402813
N'-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide (PubChem CID 9402813) has the molecular formula C11H18N5O3S+ and a molecular weight of 300.36 g/mol. Its IUPAC name is N'-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide.
| Compound Name | N'-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 9402813 |
| Molecular Formula | C11H18N5O3S+ |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N'-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide |
| SMILES | Cc1nnc(NC(=O)C(=O)NCC[NH+]2CCOCC2)s1 |
| InChI | InChI=1S/C11H17N5O3S/c1-8-14-15-11(20-8)13-10(18)9(17)12-2-3-16-4-6-19-7-5-16/h2-7H2,1H3,(H,12,17)(H,13,15,18)/p+1 |
| InChIKey | TZCAVBUBCPSCAB-UHFFFAOYSA-O |
| XLogP | -2.18 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|