C16H28N3O3+ — CID 2224635
N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-morpholin-4-ium-4-ylethyl)oxamide (PubChem CID 2224635) has the molecular formula C16H28N3O3+ and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-morpholin-4-ium-4-ylethyl)oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-morpholin-4-ium-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 2224635 |
| Molecular Formula | C16H28N3O3+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-morpholin-4-ium-4-ylethyl)oxamide |
| SMILES | O=C(NCCC1=CCCCC1)C(=O)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C16H27N3O3/c20-15(17-7-6-14-4-2-1-3-5-14)16(21)18-8-9-19-10-12-22-13-11-19/h4H,1-3,5-13H2,(H,17,20)(H,18,21)/p+1 |
| InChIKey | TXMXHIGAGJXYJH-UHFFFAOYSA-O |
| XLogP | -0.98 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|