C23H31N4O3S+ — CID 4088972
3-[2-(cyclohexen-1-yl)ethyl]-N-(2-morpholin-4-ium-4-ylethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 4088972) has the molecular formula C23H31N4O3S+ and a molecular weight of 443.59 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-N-(2-morpholin-4-ium-4-ylethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-N-(2-morpholin-4-ium-4-ylethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 4088972 |
| Molecular Formula | C23H31N4O3S+ |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-N-(2-morpholin-4-ium-4-ylethyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1ccc2c(=O)n(CCC3=CCCCC3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C23H30N4O3S/c28-21(24-9-11-26-12-14-30-15-13-26)18-6-7-19-20(16-18)25-23(31)27(22(19)29)10-8-17-4-2-1-3-5-17/h4,6-7,16H,1-3,5,8-15H2,(H,24,28)(H,25,31)/p+1 |
| InChIKey | YMEVOAOCNUMWQS-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|