C15H22N3O2S+ — CID 7349244
2-methyl-N-(2-morpholin-4-ium-4-ylethylcarbamothioyl)benzamide (PubChem CID 7349244) has the molecular formula C15H22N3O2S+ and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-methyl-N-(2-morpholin-4-ium-4-ylethylcarbamothioyl)benzamide.
| Compound Name | 2-methyl-N-(2-morpholin-4-ium-4-ylethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 7349244 |
| Molecular Formula | C15H22N3O2S+ |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-methyl-N-(2-morpholin-4-ium-4-ylethylcarbamothioyl)benzamide |
| SMILES | Cc1ccccc1C(=O)NC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H21N3O2S/c1-12-4-2-3-5-13(12)14(19)17-15(21)16-6-7-18-8-10-20-11-9-18/h2-5H,6-11H2,1H3,(H2,16,17,19,21)/p+1 |
| InChIKey | SSGWXJMFZLUGSD-UHFFFAOYSA-O |
| XLogP | -0.49 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|