C18H23N4O3S+ — CID 8669415
1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8669415) has the molecular formula C18H23N4O3S+ and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8669415 |
| Molecular Formula | C18H23N4O3S+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 1-[(3-hydroxynaphthalene-2-carbonyl)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | O=C(NNC(=S)NCC[NH+]1CCOCC1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H22N4O3S/c23-16-12-14-4-2-1-3-13(14)11-15(16)17(24)20-21-18(26)19-5-6-22-7-9-25-10-8-22/h1-4,11-12,23H,5-10H2,(H,20,24)(H2,19,21,26)/p+1 |
| InChIKey | UYMCYIAPHFDDIK-UHFFFAOYSA-O |
| XLogP | -0.43 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|