C19H27N6O3S+ — CID 8747612
1-(2-morpholin-4-ium-4-ylethyl)-3-[(4-oxo-3-propylphthalazine-1-carbonyl)amino]thiourea (PubChem CID 8747612) has the molecular formula C19H27N6O3S+ and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(2-morpholin-4-ium-4-ylethyl)-3-[(4-oxo-3-propylphthalazine-1-carbonyl)amino]thiourea.
| Compound Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-[(4-oxo-3-propylphthalazine-1-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 8747612 |
| Molecular Formula | C19H27N6O3S+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-[(4-oxo-3-propylphthalazine-1-carbonyl)amino]thiourea |
| SMILES | CCCn1nc(C(=O)NNC(=S)NCC[NH+]2CCOCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C19H26N6O3S/c1-2-8-25-18(27)15-6-4-3-5-14(15)16(23-25)17(26)21-22-19(29)20-7-9-24-10-12-28-13-11-24/h3-6H,2,7-13H2,1H3,(H,21,26)(H2,20,22,29)/p+1 |
| InChIKey | RIKFTKSFCHVDOW-UHFFFAOYSA-O |
| XLogP | -1.17 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|