C19H27N4O3+ — CID 9120294
3-butyl-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide (PubChem CID 9120294) has the molecular formula C19H27N4O3+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-butyl-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-butyl-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9120294 |
| Molecular Formula | C19H27N4O3+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-butyl-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide |
| SMILES | CCCCn1nc(C(=O)NCC[NH+]2CCOCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C19H26N4O3/c1-2-3-9-23-19(25)16-7-5-4-6-15(16)17(21-23)18(24)20-8-10-22-11-13-26-14-12-22/h4-7H,2-3,8-14H2,1H3,(H,20,24)/p+1 |
| InChIKey | WFWYGDGVTXODLK-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |