C20H30N4O2 — CID 119639720
N-(2-amino-2-ethylbutyl)-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 119639720) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 119639720 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)NCC(N)(CC)CC)c2ccccc2c1=O |
| InChI | InChI=1S/C20H30N4O2/c1-4-7-10-13-24-19(26)16-12-9-8-11-15(16)17(23-24)18(25)22-14-20(21,5-2)6-3/h8-9,11-12H,4-7,10,13-14,21H2,1-3H3,(H,22,25) |
| InChIKey | QEWLWFOMKDOAFG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|