C23H25N3O4 — CID 55350443
benzyl 2-[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]acetate (PubChem CID 55350443) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is benzyl 2-[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]acetate.
| Compound Name | benzyl 2-[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 55350443 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | benzyl 2-[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]acetate |
| SMILES | CCCCCn1nc(C(=O)NCC(=O)OCc2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H25N3O4/c1-2-3-9-14-26-23(29)19-13-8-7-12-18(19)21(25-26)22(28)24-15-20(27)30-16-17-10-5-4-6-11-17/h4-8,10-13H,2-3,9,14-16H2,1H3,(H,24,28) |
| InChIKey | PGSSQCWIQGTWMK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|