C16H21N3O2 — CID 46652418
N,N-dimethyl-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 46652418) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N,N-dimethyl-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 46652418 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N,N-dimethyl-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)N(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C16H21N3O2/c1-4-5-8-11-19-15(20)13-10-7-6-9-12(13)14(17-19)16(21)18(2)3/h6-7,9-10H,4-5,8,11H2,1-3H3 |
| InChIKey | URJMLONPBITOTC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|