C19H27N3O2 — CID 78796231
N-butyl-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 78796231) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-butyl-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-butyl-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 78796231 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-butyl-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)N(C)CCCC)c2ccccc2c1=O |
| InChI | InChI=1S/C19H27N3O2/c1-4-6-10-14-22-18(23)16-12-9-8-11-15(16)17(20-22)19(24)21(3)13-7-5-2/h8-9,11-12H,4-7,10,13-14H2,1-3H3 |
| InChIKey | CADAFKORODYMKH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|