C22H24FN3O2 — CID 78781512
N-[(3-fluorophenyl)methyl]-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 78781512) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 78781512 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-methyl-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)N(C)Cc2cccc(F)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H24FN3O2/c1-3-4-7-13-26-21(27)19-12-6-5-11-18(19)20(24-26)22(28)25(2)15-16-9-8-10-17(23)14-16/h5-6,8-12,14H,3-4,7,13,15H2,1-2H3 |
| InChIKey | HTNOFXQSMOJNQZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|