C24H28N4O2 — CID 31645422
N-methyl-4-oxo-3-propyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]phthalazine-1-carboxamide (PubChem CID 31645422) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-methyl-4-oxo-3-propyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]phthalazine-1-carboxamide.
| Compound Name | N-methyl-4-oxo-3-propyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 31645422 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-methyl-4-oxo-3-propyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]phthalazine-1-carboxamide |
| SMILES | CCCn1nc(C(=O)N(C)Cc2ccccc2N2CCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H28N4O2/c1-3-14-28-23(29)20-12-6-5-11-19(20)22(25-28)24(30)26(2)17-18-10-4-7-13-21(18)27-15-8-9-16-27/h4-7,10-13H,3,8-9,14-17H2,1-2H3 |
| InChIKey | ZWAIANDWLYBXGR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |