C22H25N3O2 — CID 51158160
N-methyl-N-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide (PubChem CID 51158160) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-methyl-N-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | N-methyl-N-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 51158160 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-methyl-N-[(2-methylphenyl)methyl]-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide |
| SMILES | Cc1ccccc1CN(C)C(=O)c1nn(CC(C)C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H25N3O2/c1-15(2)13-25-21(26)19-12-8-7-11-18(19)20(23-25)22(27)24(4)14-17-10-6-5-9-16(17)3/h5-12,15H,13-14H2,1-4H3 |
| InChIKey | NYLOTHLVGUKXRU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |