C21H20F2N2O3 — CID 55443591
(2,3-difluorophenyl)methyl 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 55443591) has the molecular formula C21H20F2N2O3 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2,3-difluorophenyl)methyl 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | (2,3-difluorophenyl)methyl 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 55443591 |
| Molecular Formula | C21H20F2N2O3 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2,3-difluorophenyl)methyl 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCc2cccc(F)c2F)c2ccccc2c1=O |
| InChI | InChI=1S/C21H20F2N2O3/c1-2-3-6-12-25-20(26)16-10-5-4-9-15(16)19(24-25)21(27)28-13-14-8-7-11-17(22)18(14)23/h4-5,7-11H,2-3,6,12-13H2,1H3 |
| InChIKey | QPYGMSDLVNYRLS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|