C23H26N2O4 — CID 55568775
3-phenoxypropyl 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 55568775) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-phenoxypropyl 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | 3-phenoxypropyl 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 55568775 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-phenoxypropyl 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCCCOc2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H26N2O4/c1-2-3-9-15-25-22(26)20-14-8-7-13-19(20)21(24-25)23(27)29-17-10-16-28-18-11-5-4-6-12-18/h4-8,11-14H,2-3,9-10,15-17H2,1H3 |
| InChIKey | BBMHAWQWGSHHPS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|