C22H23N3O5 — CID 7169536
(4-nitrophenyl)methyl 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 7169536) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7169536 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (4-nitrophenyl)methyl 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)OCc2ccc([N+](=O)[O-])cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H23N3O5/c1-2-3-4-7-14-24-21(26)19-9-6-5-8-18(19)20(23-24)22(27)30-15-16-10-12-17(13-11-16)25(28)29/h5-6,8-13H,2-4,7,14-15H2,1H3 |
| InChIKey | OBUYYEFNCRAAFA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|