C20H25N5O2 — CID 9460938
N-(3-imidazol-1-ylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 9460938) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9460938 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)NCCCn2ccnc2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H25N5O2/c1-2-3-6-13-25-20(27)17-9-5-4-8-16(17)18(23-25)19(26)22-10-7-12-24-14-11-21-15-24/h4-5,8-9,11,14-15H,2-3,6-7,10,12-13H2,1H3,(H,22,26) |
| InChIKey | FQVVXWOROASTLX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|