C25H31N3O3 — CID 55483560
4-oxo-3-pentyl-N-[3-(1-phenylethoxy)propyl]phthalazine-1-carboxamide (PubChem CID 55483560) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N-[3-(1-phenylethoxy)propyl]phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-pentyl-N-[3-(1-phenylethoxy)propyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55483560 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-oxo-3-pentyl-N-[3-(1-phenylethoxy)propyl]phthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)NCCCOC(C)c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H31N3O3/c1-3-4-10-17-28-25(30)22-15-9-8-14-21(22)23(27-28)24(29)26-16-11-18-31-19(2)20-12-6-5-7-13-20/h5-9,12-15,19H,3-4,10-11,16-18H2,1-2H3,(H,26,29) |
| InChIKey | WFLRSSXAXPXOPH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|