C27H31N5O2 — CID 46473758
N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 46473758) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 46473758 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)NCCCc2cn(-c3ccccc3)nc2C)c2ccccc2c1=O |
| InChI | InChI=1S/C27H31N5O2/c1-3-4-10-18-31-27(34)24-16-9-8-15-23(24)25(30-31)26(33)28-17-11-12-21-19-32(29-20(21)2)22-13-6-5-7-14-22/h5-9,13-16,19H,3-4,10-12,17-18H2,1-2H3,(H,28,33) |
| InChIKey | FYHPOWQASNABDV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|