C19H18Cl2N4O — CID 46473562
3,6-dichloro-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyridine-2-carboxamide (PubChem CID 46473562) has the molecular formula C19H18Cl2N4O and a molecular weight of 389.29 g/mol. Its IUPAC name is 3,6-dichloro-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46473562 |
| Molecular Formula | C19H18Cl2N4O |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3,6-dichloro-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]pyridine-2-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)cc1CCCNC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H18Cl2N4O/c1-13-14(12-25(24-13)15-7-3-2-4-8-15)6-5-11-22-19(26)18-16(20)9-10-17(21)23-18/h2-4,7-10,12H,5-6,11H2,1H3,(H,22,26) |
| InChIKey | YPJIIPJOQJMALJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|