C23H22N4O — CID 71685784
N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]quinoline-8-carboxamide (PubChem CID 71685784) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]quinoline-8-carboxamide.
| Compound Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 71685784 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]quinoline-8-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)cc1CCCNC(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C23H22N4O/c1-17-19(16-27(26-17)20-11-3-2-4-12-20)10-7-15-25-23(28)21-13-5-8-18-9-6-14-24-22(18)21/h2-6,8-9,11-14,16H,7,10,15H2,1H3,(H,25,28) |
| InChIKey | XMAMEWXUSFSKPQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|