C27H24N4OS — CID 60545040
2-(2-cyanophenyl)sulfanyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide (PubChem CID 60545040) has the molecular formula C27H24N4OS and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 60545040 |
| Molecular Formula | C27H24N4OS |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide |
| SMILES | Cc1nn(-c2ccccc2)cc1CCCNC(=O)c1ccccc1Sc1ccccc1C#N |
| InChI | InChI=1S/C27H24N4OS/c1-20-22(19-31(30-20)23-12-3-2-4-13-23)11-9-17-29-27(32)24-14-6-8-16-26(24)33-25-15-7-5-10-21(25)18-28/h2-8,10,12-16,19H,9,11,17H2,1H3,(H,29,32) |
| InChIKey | OKITVDOEBWMWBN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|